C14H20N4O3 — CID 107317940
4-(5-hydroxypentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid (PubChem CID 107317940) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 4-(5-hydroxypentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid.
| Compound Name | 4-(5-hydroxypentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid |
|---|---|
| PubChem CID | 107317940 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 4-(5-hydroxypentylamino)-1,3-dimethylpyrazolo[3,4-b]pyridine-5-carboxylic acid |
| SMILES | Cc1nn(C)c2ncc(C(=O)O)c(NCCCCCO)c12 |
| InChI | InChI=1S/C14H20N4O3/c1-9-11-12(15-6-4-3-5-7-19)10(14(20)21)8-16-13(11)18(2)17-9/h8,19H,3-7H2,1-2H3,(H,15,16)(H,20,21) |
| InChIKey | GADMUEZHPJRXKA-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|