About 3,4-dihexoxythiophene
3,4-dihexoxythiophene (PubChem CID 10731808) has the molecular formula C16H28O2S
and a molecular weight of 284.46 g/mol. Its IUPAC name is 3,4-dihexoxythiophene.
Molecular Properties
| Compound Name | 3,4-dihexoxythiophene |
| PubChem CID | 10731808 |
| Molecular Formula | C16H28O2S |
| Molecular Weight | 284.46 g/mol |
| Exact Mass | 284.18 |
| IUPAC Name | 3,4-dihexoxythiophene |
| SMILES | CCCCCCOc1cscc1OCCCCCC |
| InChI | InChI=1S/C16H28O2S/c1-3-5-7-9-11-17-15-13-19-14-16(15)18-12-10-8-6-4-2/h13-14H,3-12H2,1-2H3 |
| InChIKey | OMANTHZRUHGCNC-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 284.46 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3,4-dihexoxythiophene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dihexoxythiophene?
The IUPAC name of 3,4-dihexoxythiophene (CID 10731808) is 3,4-dihexoxythiophene.
What is the SMILES notation for 3,4-dihexoxythiophene?
The canonical SMILES for 3,4-dihexoxythiophene is CCCCCCOc1cscc1OCCCCCC.
What is the InChIKey of 3,4-dihexoxythiophene?
The InChIKey is OMANTHZRUHGCNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H28O2S/c1-3-5-7-9-11-17-15-13-19-14-16(15)18-12-10-8-6-4-2/h13-14H,3-12H2,1-2H3.
What are the key properties of 3,4-dihexoxythiophene?
3,4-dihexoxythiophene has a molecular weight of 284.46 g/mol, XLogP of 5.67, 12 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dihexoxythiophene is sourced from PubChem (CID 10731808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).