C16H23NO2 — CID 107318401
N-(5-hydroxypentyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide (PubChem CID 107318401) has the molecular formula C16H23NO2 and a molecular weight of 261.37 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide.
| Compound Name | N-(5-hydroxypentyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 107318401 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | N-(5-hydroxypentyl)-1,2,3,4-tetrahydronaphthalene-1-carboxamide |
| SMILES | O=C(NCCCCCO)C1CCCc2ccccc21 |
| InChI | InChI=1S/C16H23NO2/c18-12-5-1-4-11-17-16(19)15-10-6-8-13-7-2-3-9-14(13)15/h2-3,7,9,15,18H,1,4-6,8,10-12H2,(H,17,19) |
| InChIKey | VPQDQUQAXPVJEJ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|