About 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate
2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate (PubChem CID 10731847) has the molecular formula C12H15NO5S
and a molecular weight of 285.32 g/mol. Its IUPAC name is 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate |
| PubChem CID | 10731847 |
| Molecular Formula | C12H15NO5S |
| Molecular Weight | 285.32 g/mol |
| Exact Mass | 285.07 |
| IUPAC Name | 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC[C@H]2COC(=O)N2)cc1 |
| InChI | InChI=1S/C12H15NO5S/c1-9-2-4-11(5-3-9)19(15,16)18-7-6-10-8-17-12(14)13-10/h2-5,10H,6-8H2,1H3,(H,13,14)/t10-/m0/s1 |
| InChIKey | CZSNZWOFQTYEIG-JTQLQIEISA-N |
| XLogP | 1.20 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.32 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate?
The IUPAC name of 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate (CID 10731847) is 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate.
What is the SMILES notation for 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate?
The canonical SMILES for 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate is Cc1ccc(S(=O)(=O)OCC[C@H]2COC(=O)N2)cc1.
What is the InChIKey of 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate?
The InChIKey is CZSNZWOFQTYEIG-JTQLQIEISA-N. The full InChI is InChI=1S/C12H15NO5S/c1-9-2-4-11(5-3-9)19(15,16)18-7-6-10-8-17-12(14)13-10/h2-5,10H,6-8H2,1H3,(H,13,14)/t10-/m0/s1.
What are the key properties of 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate?
2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate has a molecular weight of 285.32 g/mol, XLogP of 1.20, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-2-oxo-1,3-oxazolidin-4-yl]ethyl 4-methylbenzenesulfonate is sourced from PubChem (CID 10731847), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).