C13H17F2NO2S — CID 107319095
2-(3,4-difluorophenyl)sulfanyl-N-(5-hydroxypentyl)acetamide (PubChem CID 107319095) has the molecular formula C13H17F2NO2S and a molecular weight of 289.35 g/mol. Its IUPAC name is 2-(3,4-difluorophenyl)sulfanyl-N-(5-hydroxypentyl)acetamide.
| Compound Name | 2-(3,4-difluorophenyl)sulfanyl-N-(5-hydroxypentyl)acetamide |
|---|---|
| PubChem CID | 107319095 |
| Molecular Formula | C13H17F2NO2S |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | 2-(3,4-difluorophenyl)sulfanyl-N-(5-hydroxypentyl)acetamide |
| SMILES | O=C(CSc1ccc(F)c(F)c1)NCCCCCO |
| InChI | InChI=1S/C13H17F2NO2S/c14-11-5-4-10(8-12(11)15)19-9-13(18)16-6-2-1-3-7-17/h4-5,8,17H,1-3,6-7,9H2,(H,16,18) |
| InChIKey | YIWOJQZJEXORAI-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|