C14H18N2O4 — CID 107319129
(E)-N-(5-hydroxypentyl)-3-(2-nitrophenyl)prop-2-enamide (PubChem CID 107319129) has the molecular formula C14H18N2O4 and a molecular weight of 278.31 g/mol. Its IUPAC name is (E)-N-(5-hydroxypentyl)-3-(2-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-(5-hydroxypentyl)-3-(2-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 107319129 |
| Molecular Formula | C14H18N2O4 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.13 |
| IUPAC Name | (E)-N-(5-hydroxypentyl)-3-(2-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1[N+](=O)[O-])NCCCCCO |
| InChI | InChI=1S/C14H18N2O4/c17-11-5-1-4-10-15-14(18)9-8-12-6-2-3-7-13(12)16(19)20/h2-3,6-9,17H,1,4-5,10-11H2,(H,15,18)/b9-8+ |
| InChIKey | YQIWLHUMLMEVAE-CMDGGOBGSA-N |
| XLogP | 1.89 |
| TPSA | 92.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|