C14H19N3O2 — CID 107319165
N-(5-hydroxypentyl)-5-methylimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 107319165) has the molecular formula C14H19N3O2 and a molecular weight of 261.32 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-5-methylimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-(5-hydroxypentyl)-5-methylimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 107319165 |
| Molecular Formula | C14H19N3O2 |
| Molecular Weight | 261.32 g/mol |
| Exact Mass | 261.15 |
| IUPAC Name | N-(5-hydroxypentyl)-5-methylimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | Cc1cccc2nc(C(=O)NCCCCCO)cn12 |
| InChI | InChI=1S/C14H19N3O2/c1-11-6-5-7-13-16-12(10-17(11)13)14(19)15-8-3-2-4-9-18/h5-7,10,18H,2-4,8-9H2,1H3,(H,15,19) |
| InChIKey | WTHOGWJSBQBAHF-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 66.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.32 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|