C12H12BrClO — CID 10732054
(1R,9R)-13-bromo-6-chloro-8-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene (PubChem CID 10732054) has the molecular formula C12H12BrClO and a molecular weight of 287.58 g/mol. Its IUPAC name is (1R,9R)-13-bromo-6-chloro-8-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene.
| Compound Name | (1R,9R)-13-bromo-6-chloro-8-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene |
|---|---|
| PubChem CID | 10732054 |
| Molecular Formula | C12H12BrClO |
| Molecular Weight | 287.58 g/mol |
| Exact Mass | 285.98 |
| IUPAC Name | (1R,9R)-13-bromo-6-chloro-8-oxatricyclo[7.3.1.02,7]trideca-2(7),3,5-triene |
| SMILES | Clc1cccc2c1O[C@@H]1CCC[C@H]2C1Br |
| InChI | InChI=1S/C12H12BrClO/c13-11-7-3-2-6-10(11)15-12-8(7)4-1-5-9(12)14/h1,4-5,7,10-11H,2-3,6H2/t7-,10-,11?/m1/s1 |
| InChIKey | PSIWUURURAXNAG-LSLVDHONSA-N |
| XLogP | 4.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.58 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|