C10H10BrNO4 — CID 10732060
methyl (2R,3R)-3-bromo-2-methoxy-2,3-dihydrofuro[3,2-b]pyridine-5-carboxylate (PubChem CID 10732060) has the molecular formula C10H10BrNO4 and a molecular weight of 288.10 g/mol. Its IUPAC name is methyl (2R,3R)-3-bromo-2-methoxy-2,3-dihydrofuro[3,2-b]pyridine-5-carboxylate.
| Compound Name | methyl (2R,3R)-3-bromo-2-methoxy-2,3-dihydrofuro[3,2-b]pyridine-5-carboxylate |
|---|---|
| PubChem CID | 10732060 |
| Molecular Formula | C10H10BrNO4 |
| Molecular Weight | 288.10 g/mol |
| Exact Mass | 286.98 |
| IUPAC Name | methyl (2R,3R)-3-bromo-2-methoxy-2,3-dihydrofuro[3,2-b]pyridine-5-carboxylate |
| SMILES | COC(=O)c1ccc2c(n1)[C@@H](Br)[C@H](OC)O2 |
| InChI | InChI=1S/C10H10BrNO4/c1-14-9(13)5-3-4-6-8(12-5)7(11)10(15-2)16-6/h3-4,7,10H,1-2H3/t7-,10-/m1/s1 |
| InChIKey | DRGVCPWMGIFKQL-GMSGAONNSA-N |
| XLogP | 1.67 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.10 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|