About 6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid
6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid (PubChem CID 10732070) has the molecular formula C11H13FN2O6
and a molecular weight of 288.23 g/mol. Its IUPAC name is 6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid.
Molecular Properties
| Compound Name | 6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid |
| PubChem CID | 10732070 |
| Molecular Formula | C11H13FN2O6 |
| Molecular Weight | 288.23 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid |
| SMILES | O=C(O)CCCCC(=O)OCn1cc(F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H13FN2O6/c12-7-5-14(11(19)13-10(7)18)6-20-9(17)4-2-1-3-8(15)16/h5H,1-4,6H2,(H,15,16)(H,13,18,19) |
| InChIKey | WRFZOBHAZYVZRF-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid?
The IUPAC name of 6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid (CID 10732070) is 6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid.
What is the SMILES notation for 6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid?
The canonical SMILES for 6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid is O=C(O)CCCCC(=O)OCn1cc(F)c(=O)[nH]c1=O.
What is the InChIKey of 6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid?
The InChIKey is WRFZOBHAZYVZRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13FN2O6/c12-7-5-14(11(19)13-10(7)18)6-20-9(17)4-2-1-3-8(15)16/h5H,1-4,6H2,(H,15,16)(H,13,18,19).
What are the key properties of 6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid?
6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid has a molecular weight of 288.23 g/mol, XLogP of -0.18, 7 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(5-fluoro-2,4-dioxopyrimidin-1-yl)methoxy]-6-oxohexanoic acid is sourced from PubChem (CID 10732070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).