C18H30BrNO — CID 107322108
N-(5-bromopentyl)-3,5-dimethyladamantane-1-carboxamide (PubChem CID 107322108) has the molecular formula C18H30BrNO and a molecular weight of 356.35 g/mol. Its IUPAC name is N-(5-bromopentyl)-3,5-dimethyladamantane-1-carboxamide.
| Compound Name | N-(5-bromopentyl)-3,5-dimethyladamantane-1-carboxamide |
|---|---|
| PubChem CID | 107322108 |
| Molecular Formula | C18H30BrNO |
| Molecular Weight | 356.35 g/mol |
| Exact Mass | 355.15 |
| IUPAC Name | N-(5-bromopentyl)-3,5-dimethyladamantane-1-carboxamide |
| SMILES | CC12CC3CC(C)(C1)CC(C(=O)NCCCCCBr)(C3)C2 |
| InChI | InChI=1S/C18H30BrNO/c1-16-8-14-9-17(2,11-16)13-18(10-14,12-16)15(21)20-7-5-3-4-6-19/h14H,3-13H2,1-2H3,(H,20,21) |
| InChIKey | FFMQJYQFCLXLGY-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.35 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|