C14H15ClN2O3 — CID 107322916
3-amino-1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]pyrrolidine-3-carboxylic acid (PubChem CID 107322916) has the molecular formula C14H15ClN2O3 and a molecular weight of 294.74 g/mol. Its IUPAC name is 3-amino-1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107322916 |
| Molecular Formula | C14H15ClN2O3 |
| Molecular Weight | 294.74 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 3-amino-1-[(E)-3-(4-chlorophenyl)prop-2-enoyl]pyrrolidine-3-carboxylic acid |
| SMILES | NC1(C(=O)O)CCN(C(=O)/C=C/c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C14H15ClN2O3/c15-11-4-1-10(2-5-11)3-6-12(18)17-8-7-14(16,9-17)13(19)20/h1-6H,7-9,16H2,(H,19,20)/b6-3+ |
| InChIKey | MJNSWBPKTYALDR-ZZXKWVIFSA-N |
| XLogP | 1.37 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.74 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|