About N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide
N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide (PubChem CID 107322999) has the molecular formula C9H17BrF3NO2S
and a molecular weight of 340.21 g/mol. Its IUPAC name is N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide.
Molecular Properties
| Compound Name | N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide |
| PubChem CID | 107322999 |
| Molecular Formula | C9H17BrF3NO2S |
| Molecular Weight | 340.21 g/mol |
| Exact Mass | 339.01 |
| IUPAC Name | N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide |
| SMILES | O=S(=O)(CCCC(F)(F)F)NCCCCCBr |
| InChI | InChI=1S/C9H17BrF3NO2S/c10-6-2-1-3-7-14-17(15,16)8-4-5-9(11,12)13/h14H,1-8H2 |
| InChIKey | BAYNKNHBXVJFLJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.21 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide?
The IUPAC name of N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide (CID 107322999) is N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide.
What is the SMILES notation for N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide?
The canonical SMILES for N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide is O=S(=O)(CCCC(F)(F)F)NCCCCCBr.
What is the InChIKey of N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide?
The InChIKey is BAYNKNHBXVJFLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17BrF3NO2S/c10-6-2-1-3-7-14-17(15,16)8-4-5-9(11,12)13/h14H,1-8H2.
What are the key properties of N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide?
N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide has a molecular weight of 340.21 g/mol, XLogP of 2.81, 9 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-bromopentyl)-4,4,4-trifluorobutane-1-sulfonamide is sourced from PubChem (CID 107322999), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).