C13H19NO2S — CID 107323824
N-(5-hydroxypentyl)-2-methyl-5-sulfanylbenzamide (PubChem CID 107323824) has the molecular formula C13H19NO2S and a molecular weight of 253.37 g/mol. Its IUPAC name is N-(5-hydroxypentyl)-2-methyl-5-sulfanylbenzamide.
| Compound Name | N-(5-hydroxypentyl)-2-methyl-5-sulfanylbenzamide |
|---|---|
| PubChem CID | 107323824 |
| Molecular Formula | C13H19NO2S |
| Molecular Weight | 253.37 g/mol |
| Exact Mass | 253.11 |
| IUPAC Name | N-(5-hydroxypentyl)-2-methyl-5-sulfanylbenzamide |
| SMILES | Cc1ccc(S)cc1C(=O)NCCCCCO |
| InChI | InChI=1S/C13H19NO2S/c1-10-5-6-11(17)9-12(10)13(16)14-7-3-2-4-8-15/h5-6,9,15,17H,2-4,7-8H2,1H3,(H,14,16) |
| InChIKey | CKACNMLQGCURMM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.37 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|