C18H28O3 — CID 10732425
(3aR,4S,7E,11aR)-2,2-dimethyl-11-methylidene-4-propan-2-yl-4,5,6,9,10,11a-hexahydro-3aH-cyclodeca[d][1,3]dioxole-7-carbaldehyde (PubChem CID 10732425) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is (3aR,4S,7E,11aR)-2,2-dimethyl-11-methylidene-4-propan-2-yl-4,5,6,9,10,11a-hexahydro-3aH-cyclodeca[d][1,3]dioxole-7-carbaldehyde.
| Compound Name | (3aR,4S,7E,11aR)-2,2-dimethyl-11-methylidene-4-propan-2-yl-4,5,6,9,10,11a-hexahydro-3aH-cyclodeca[d][1,3]dioxole-7-carbaldehyde |
|---|---|
| PubChem CID | 10732425 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | (3aR,4S,7E,11aR)-2,2-dimethyl-11-methylidene-4-propan-2-yl-4,5,6,9,10,11a-hexahydro-3aH-cyclodeca[d][1,3]dioxole-7-carbaldehyde |
| SMILES | C=C1CC/C=C(/C=O)CC[C@@H](C(C)C)[C@H]2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C18H28O3/c1-12(2)15-10-9-14(11-19)8-6-7-13(3)16-17(15)21-18(4,5)20-16/h8,11-12,15-17H,3,6-7,9-10H2,1-2,4-5H3/b14-8+/t15-,16+,17+/m0/s1 |
| InChIKey | AKFRRESBNLJJPI-MXZWTXISSA-N |
| XLogP | 4.03 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|