C13H18N4OS — CID 107324546
5-[(3-amino-4-pyridin-3-yl-1,2-thiazol-5-yl)amino]pentan-1-ol (PubChem CID 107324546) has the molecular formula C13H18N4OS and a molecular weight of 278.38 g/mol. Its IUPAC name is 5-[(3-amino-4-pyridin-3-yl-1,2-thiazol-5-yl)amino]pentan-1-ol.
| Compound Name | 5-[(3-amino-4-pyridin-3-yl-1,2-thiazol-5-yl)amino]pentan-1-ol |
|---|---|
| PubChem CID | 107324546 |
| Molecular Formula | C13H18N4OS |
| Molecular Weight | 278.38 g/mol |
| Exact Mass | 278.12 |
| IUPAC Name | 5-[(3-amino-4-pyridin-3-yl-1,2-thiazol-5-yl)amino]pentan-1-ol |
| SMILES | Nc1nsc(NCCCCCO)c1-c1cccnc1 |
| InChI | InChI=1S/C13H18N4OS/c14-12-11(10-5-4-6-15-9-10)13(19-17-12)16-7-2-1-3-8-18/h4-6,9,16,18H,1-3,7-8H2,(H2,14,17) |
| InChIKey | RIRUFQMNMMMWND-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 84.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.38 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|