C14H18ClN3O3 — CID 107325039
3-amino-1-[2-(3-chloro-4-methylanilino)-2-oxoethyl]pyrrolidine-3-carboxylic acid (PubChem CID 107325039) has the molecular formula C14H18ClN3O3 and a molecular weight of 311.77 g/mol. Its IUPAC name is 3-amino-1-[2-(3-chloro-4-methylanilino)-2-oxoethyl]pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-[2-(3-chloro-4-methylanilino)-2-oxoethyl]pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107325039 |
| Molecular Formula | C14H18ClN3O3 |
| Molecular Weight | 311.77 g/mol |
| Exact Mass | 311.10 |
| IUPAC Name | 3-amino-1-[2-(3-chloro-4-methylanilino)-2-oxoethyl]pyrrolidine-3-carboxylic acid |
| SMILES | Cc1ccc(NC(=O)CN2CCC(N)(C(=O)O)C2)cc1Cl |
| InChI | InChI=1S/C14H18ClN3O3/c1-9-2-3-10(6-11(9)15)17-12(19)7-18-5-4-14(16,8-18)13(20)21/h2-3,6H,4-5,7-8,16H2,1H3,(H,17,19)(H,20,21) |
| InChIKey | PEKPCOVVLWRXSK-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 95.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.77 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |