C10H11N5O2 — CID 107325250
3-amino-1-(5-cyanopyrazin-2-yl)pyrrolidine-3-carboxylic acid (PubChem CID 107325250) has the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. Its IUPAC name is 3-amino-1-(5-cyanopyrazin-2-yl)pyrrolidine-3-carboxylic acid.
| Compound Name | 3-amino-1-(5-cyanopyrazin-2-yl)pyrrolidine-3-carboxylic acid |
|---|---|
| PubChem CID | 107325250 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 3-amino-1-(5-cyanopyrazin-2-yl)pyrrolidine-3-carboxylic acid |
| SMILES | N#Cc1cnc(N2CCC(N)(C(=O)O)C2)cn1 |
| InChI | InChI=1S/C10H11N5O2/c11-3-7-4-14-8(5-13-7)15-2-1-10(12,6-15)9(16)17/h4-5H,1-2,6,12H2,(H,16,17) |
| InChIKey | RKHGQVWOOUGCRR-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 116.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |