About 2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid
2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid (PubChem CID 10732602) has the molecular formula C12H9NO8
and a molecular weight of 295.20 g/mol. Its IUPAC name is 2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid.
Molecular Properties
| Compound Name | 2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid |
| PubChem CID | 10732602 |
| Molecular Formula | C12H9NO8 |
| Molecular Weight | 295.20 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | 2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid |
| SMILES | COC(=O)Oc1cccc2c(=O)n(CC(=O)O)c(=O)oc12 |
| InChI | InChI=1S/C12H9NO8/c1-19-12(18)20-7-4-2-3-6-9(7)21-11(17)13(10(6)16)5-8(14)15/h2-4H,5H2,1H3,(H,14,15) |
| InChIKey | AXYKSPZONGZELE-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 125.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.20 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze 2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid?
The IUPAC name of 2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid (CID 10732602) is 2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid.
What is the SMILES notation for 2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid?
The canonical SMILES for 2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid is COC(=O)Oc1cccc2c(=O)n(CC(=O)O)c(=O)oc12.
What is the InChIKey of 2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid?
The InChIKey is AXYKSPZONGZELE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO8/c1-19-12(18)20-7-4-2-3-6-9(7)21-11(17)13(10(6)16)5-8(14)15/h2-4H,5H2,1H3,(H,14,15).
What are the key properties of 2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid?
2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid has a molecular weight of 295.20 g/mol, XLogP of 0.18, 3 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(8-methoxycarbonyloxy-2,4-dioxo-1,3-benzoxazin-3-yl)acetic acid is sourced from PubChem (CID 10732602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).