About 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea
2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea (PubChem CID 107326067) has the molecular formula C11H17FN4O3S
and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea.
Molecular Properties
| Compound Name | 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea |
| PubChem CID | 107326067 |
| Molecular Formula | C11H17FN4O3S |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea |
| SMILES | Cc1cc(F)c(N)c(C)c1S(=O)(=O)NCCNC(N)=O |
| InChI | InChI=1S/C11H17FN4O3S/c1-6-5-8(12)9(13)7(2)10(6)20(18,19)16-4-3-15-11(14)17/h5,16H,3-4,13H2,1-2H3,(H3,14,15,17) |
| InChIKey | ZNOXUMYPNXWAJF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea?
The IUPAC name of 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea (CID 107326067) is 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea.
What is the SMILES notation for 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea?
The canonical SMILES for 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea is Cc1cc(F)c(N)c(C)c1S(=O)(=O)NCCNC(N)=O.
What is the InChIKey of 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea?
The InChIKey is ZNOXUMYPNXWAJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H17FN4O3S/c1-6-5-8(12)9(13)7(2)10(6)20(18,19)16-4-3-15-11(14)17/h5,16H,3-4,13H2,1-2H3,(H3,14,15,17).
What are the key properties of 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea?
2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea has a molecular weight of 304.35 g/mol, XLogP of -0.03, 5 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonylamino]ethylurea is sourced from PubChem (CID 107326067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).