About 1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea
1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea (PubChem CID 107326249) has the molecular formula C10H14FN3O3S
and a molecular weight of 275.31 g/mol. Its IUPAC name is 1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea.
Molecular Properties
| Compound Name | 1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea |
| PubChem CID | 107326249 |
| Molecular Formula | C10H14FN3O3S |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea |
| SMILES | CNC(=O)NS(=O)(=O)c1c(C)cc(F)c(N)c1C |
| InChI | InChI=1S/C10H14FN3O3S/c1-5-4-7(11)8(12)6(2)9(5)18(16,17)14-10(15)13-3/h4H,12H2,1-3H3,(H2,13,14,15) |
| InChIKey | VINAOGIKXUJWAL-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 101.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea?
The IUPAC name of 1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea (CID 107326249) is 1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea.
What is the SMILES notation for 1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea?
The canonical SMILES for 1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea is CNC(=O)NS(=O)(=O)c1c(C)cc(F)c(N)c1C.
What is the InChIKey of 1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea?
The InChIKey is VINAOGIKXUJWAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14FN3O3S/c1-5-4-7(11)8(12)6(2)9(5)18(16,17)14-10(15)13-3/h4H,12H2,1-3H3,(H2,13,14,15).
What are the key properties of 1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea?
1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea has a molecular weight of 275.31 g/mol, XLogP of 0.64, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-amino-4-fluoro-2,6-dimethylphenyl)sulfonyl-3-methylurea is sourced from PubChem (CID 107326249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).