C17H28O4 — CID 10732718
3-(1-ethoxyethenyl)-3-prop-2-enoxy-7,12-dioxaspiro[5.6]dodecane (PubChem CID 10732718) has the molecular formula C17H28O4 and a molecular weight of 296.41 g/mol. Its IUPAC name is 3-(1-ethoxyethenyl)-3-prop-2-enoxy-7,12-dioxaspiro[5.6]dodecane.
| Compound Name | 3-(1-ethoxyethenyl)-3-prop-2-enoxy-7,12-dioxaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 10732718 |
| Molecular Formula | C17H28O4 |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.20 |
| IUPAC Name | 3-(1-ethoxyethenyl)-3-prop-2-enoxy-7,12-dioxaspiro[5.6]dodecane |
| SMILES | C=CCOC1(C(=C)OCC)CCC2(CC1)OCCCCO2 |
| InChI | InChI=1S/C17H28O4/c1-4-12-19-16(15(3)18-5-2)8-10-17(11-9-16)20-13-6-7-14-21-17/h4H,1,3,5-14H2,2H3 |
| InChIKey | GFTXRYDHWCHSSS-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|