C19H24N2O — CID 10732722
4-(benzhydrylideneamino)oxy-N,N-dimethylbutan-1-amine (PubChem CID 10732722) has the molecular formula C19H24N2O and a molecular weight of 296.41 g/mol. Its IUPAC name is 4-(benzhydrylideneamino)oxy-N,N-dimethylbutan-1-amine.
| Compound Name | 4-(benzhydrylideneamino)oxy-N,N-dimethylbutan-1-amine |
|---|---|
| PubChem CID | 10732722 |
| Molecular Formula | C19H24N2O |
| Molecular Weight | 296.41 g/mol |
| Exact Mass | 296.19 |
| IUPAC Name | 4-(benzhydrylideneamino)oxy-N,N-dimethylbutan-1-amine |
| SMILES | CN(C)CCCCON=C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H24N2O/c1-21(2)15-9-10-16-22-20-19(17-11-5-3-6-12-17)18-13-7-4-8-14-18/h3-8,11-14H,9-10,15-16H2,1-2H3 |
| InChIKey | BMIYIQUNSNHPNW-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 24.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|