C15H22O4S — CID 10732840
(1S,3S,6R,8R,10S)-10-(cyclopentylsulfanylmethyl)-8-hydroxy-3-methyl-2,9-dioxatricyclo[4.3.1.03,8]decan-5-one (PubChem CID 10732840) has the molecular formula C15H22O4S and a molecular weight of 298.40 g/mol. Its IUPAC name is (1S,3S,6R,8R,10S)-10-(cyclopentylsulfanylmethyl)-8-hydroxy-3-methyl-2,9-dioxatricyclo[4.3.1.03,8]decan-5-one.
| Compound Name | (1S,3S,6R,8R,10S)-10-(cyclopentylsulfanylmethyl)-8-hydroxy-3-methyl-2,9-dioxatricyclo[4.3.1.03,8]decan-5-one |
|---|---|
| PubChem CID | 10732840 |
| Molecular Formula | C15H22O4S |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | (1S,3S,6R,8R,10S)-10-(cyclopentylsulfanylmethyl)-8-hydroxy-3-methyl-2,9-dioxatricyclo[4.3.1.03,8]decan-5-one |
| SMILES | C[C@]12CC(=O)[C@@H]3C[C@@]1(O)O[C@H](O2)[C@H]3CSC1CCCC1 |
| InChI | InChI=1S/C15H22O4S/c1-14-7-12(16)10-6-15(14,17)19-13(18-14)11(10)8-20-9-4-2-3-5-9/h9-11,13,17H,2-8H2,1H3/t10-,11+,13+,14+,15-/m1/s1 |
| InChIKey | OXPSYBCZYGGZNT-VJFWYMLFSA-N |
| XLogP | 2.09 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |