About N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine
N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine (PubChem CID 10732853) has the molecular formula C19H26N2O
and a molecular weight of 298.43 g/mol. Its IUPAC name is N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine.
Molecular Properties
| Compound Name | N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine |
| PubChem CID | 10732853 |
| Molecular Formula | C19H26N2O |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine |
| SMILES | CNCCN(C)CCOC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H26N2O/c1-20-13-14-21(2)15-16-22-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3 |
| InChIKey | VAIUDQXXZGHICS-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine?
The IUPAC name of N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine (CID 10732853) is N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine.
What is the SMILES notation for N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine?
The canonical SMILES for N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine is CNCCN(C)CCOC(c1ccccc1)c1ccccc1.
What is the InChIKey of N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine?
The InChIKey is VAIUDQXXZGHICS-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O/c1-20-13-14-21(2)15-16-22-19(17-9-5-3-6-10-17)18-11-7-4-8-12-18/h3-12,19-20H,13-16H2,1-2H3.
What are the key properties of N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine?
N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine has a molecular weight of 298.43 g/mol, XLogP of 2.94, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-benzhydryloxyethyl)-N,N'-dimethylethane-1,2-diamine is sourced from PubChem (CID 10732853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).