C18H9N3O2 — CID 10732879
4-pyren-1-yl-1,2,4-triazole-3,5-dione (PubChem CID 10732879) has the molecular formula C18H9N3O2 and a molecular weight of 299.29 g/mol. Its IUPAC name is 4-pyren-1-yl-1,2,4-triazole-3,5-dione.
| Compound Name | 4-pyren-1-yl-1,2,4-triazole-3,5-dione |
|---|---|
| PubChem CID | 10732879 |
| Molecular Formula | C18H9N3O2 |
| Molecular Weight | 299.29 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 4-pyren-1-yl-1,2,4-triazole-3,5-dione |
| SMILES | O=C1N=NC(=O)N1c1ccc2ccc3cccc4ccc1c2c34 |
| InChI | InChI=1S/C18H9N3O2/c22-17-19-20-18(23)21(17)14-9-7-12-5-4-10-2-1-3-11-6-8-13(14)16(12)15(10)11/h1-9H |
| InChIKey | UBPKZWAWHBGCEE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 62.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.29 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|