C14H21NO6 — CID 10732883
[(1R,2S,8R,8aR)-1,2-diacetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl] acetate (PubChem CID 10732883) has the molecular formula C14H21NO6 and a molecular weight of 299.32 g/mol. Its IUPAC name is [(1R,2S,8R,8aR)-1,2-diacetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl] acetate.
| Compound Name | [(1R,2S,8R,8aR)-1,2-diacetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl] acetate |
|---|---|
| PubChem CID | 10732883 |
| Molecular Formula | C14H21NO6 |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | [(1R,2S,8R,8aR)-1,2-diacetyloxy-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@H]2[C@H](OC(C)=O)CCCN2C[C@@H]1OC(C)=O |
| InChI | InChI=1S/C14H21NO6/c1-8(16)19-11-5-4-6-15-7-12(20-9(2)17)14(13(11)15)21-10(3)18/h11-14H,4-7H2,1-3H3/t11-,12+,13-,14+/m1/s1 |
| InChIKey | UPCYJFRRKQJZLL-RQJABVFESA-N |
| XLogP | 0.26 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|