C20H28O2 — CID 10733005
(1R,4S,8R,9S,12R)-4,8-dimethyl-10-methylidene-9-[(2E)-3-methylpenta-2,4-dienyl]-2-oxatricyclo[6.3.1.04,12]dodecan-3-one (PubChem CID 10733005) has the molecular formula C20H28O2 and a molecular weight of 300.44 g/mol. Its IUPAC name is (1R,4S,8R,9S,12R)-4,8-dimethyl-10-methylidene-9-[(2E)-3-methylpenta-2,4-dienyl]-2-oxatricyclo[6.3.1.04,12]dodecan-3-one.
| Compound Name | (1R,4S,8R,9S,12R)-4,8-dimethyl-10-methylidene-9-[(2E)-3-methylpenta-2,4-dienyl]-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
|---|---|
| PubChem CID | 10733005 |
| Molecular Formula | C20H28O2 |
| Molecular Weight | 300.44 g/mol |
| Exact Mass | 300.21 |
| IUPAC Name | (1R,4S,8R,9S,12R)-4,8-dimethyl-10-methylidene-9-[(2E)-3-methylpenta-2,4-dienyl]-2-oxatricyclo[6.3.1.04,12]dodecan-3-one |
| SMILES | C=C/C(C)=C/C[C@H]1C(=C)C[C@H]2OC(=O)[C@@]3(C)CCC[C@@]1(C)[C@@H]23 |
| InChI | InChI=1S/C20H28O2/c1-6-13(2)8-9-15-14(3)12-16-17-19(15,4)10-7-11-20(17,5)18(21)22-16/h6,8,15-17H,1,3,7,9-12H2,2,4-5H3/b13-8+/t15-,16+,17+,19+,20-/m0/s1 |
| InChIKey | ZOWGCPFSPASCRH-PHTDPNITSA-N |
| XLogP | 4.82 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.44 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|