C16H10Cl2N2O — CID 107330203
(3,4-dichlorophenyl)-(2-phenylpyrazol-3-yl)methanone (PubChem CID 107330203) has the molecular formula C16H10Cl2N2O and a molecular weight of 317.18 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(2-phenylpyrazol-3-yl)methanone.
| Compound Name | (3,4-dichlorophenyl)-(2-phenylpyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 107330203 |
| Molecular Formula | C16H10Cl2N2O |
| Molecular Weight | 317.18 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | (3,4-dichlorophenyl)-(2-phenylpyrazol-3-yl)methanone |
| SMILES | O=C(c1ccc(Cl)c(Cl)c1)c1ccnn1-c1ccccc1 |
| InChI | InChI=1S/C16H10Cl2N2O/c17-13-7-6-11(10-14(13)18)16(21)15-8-9-19-20(15)12-4-2-1-3-5-12/h1-10H |
| InChIKey | QKHDXNQLLCUMEA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.18 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |