C17H22N2O2 — CID 107330242
2-ethoxy-3,3-dimethyl-1-(2-phenylpyrazol-3-yl)butan-1-one (PubChem CID 107330242) has the molecular formula C17H22N2O2 and a molecular weight of 286.37 g/mol. Its IUPAC name is 2-ethoxy-3,3-dimethyl-1-(2-phenylpyrazol-3-yl)butan-1-one.
| Compound Name | 2-ethoxy-3,3-dimethyl-1-(2-phenylpyrazol-3-yl)butan-1-one |
|---|---|
| PubChem CID | 107330242 |
| Molecular Formula | C17H22N2O2 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | 2-ethoxy-3,3-dimethyl-1-(2-phenylpyrazol-3-yl)butan-1-one |
| SMILES | CCOC(C(=O)c1ccnn1-c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C17H22N2O2/c1-5-21-16(17(2,3)4)15(20)14-11-12-18-19(14)13-9-7-6-8-10-13/h6-12,16H,5H2,1-4H3 |
| InChIKey | GUBPNTMPOYEELO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |