C11H9ClF2N2O — CID 107330397
2-chloro-2,2-difluoro-1-(2-phenylpyrazol-3-yl)ethanol (PubChem CID 107330397) has the molecular formula C11H9ClF2N2O and a molecular weight of 258.66 g/mol. Its IUPAC name is 2-chloro-2,2-difluoro-1-(2-phenylpyrazol-3-yl)ethanol.
| Compound Name | 2-chloro-2,2-difluoro-1-(2-phenylpyrazol-3-yl)ethanol |
|---|---|
| PubChem CID | 107330397 |
| Molecular Formula | C11H9ClF2N2O |
| Molecular Weight | 258.66 g/mol |
| Exact Mass | 258.04 |
| IUPAC Name | 2-chloro-2,2-difluoro-1-(2-phenylpyrazol-3-yl)ethanol |
| SMILES | OC(c1ccnn1-c1ccccc1)C(F)(F)Cl |
| InChI | InChI=1S/C11H9ClF2N2O/c12-11(13,14)10(17)9-6-7-15-16(9)8-4-2-1-3-5-8/h1-7,10,17H |
| InChIKey | MVMJGHUMOBASJM-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.66 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|