About 1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone
1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone (PubChem CID 10733050) has the molecular formula C20H15NO2
and a molecular weight of 301.35 g/mol. Its IUPAC name is 1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone.
Molecular Properties
| Compound Name | 1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone |
| PubChem CID | 10733050 |
| Molecular Formula | C20H15NO2 |
| Molecular Weight | 301.35 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone |
| SMILES | CC(=O)C1=C(c2ccccc2)Oc2ccccc2-n2cccc21 |
| InChI | InChI=1S/C20H15NO2/c1-14(22)19-17-11-7-13-21(17)16-10-5-6-12-18(16)23-20(19)15-8-3-2-4-9-15/h2-13H,1H3 |
| InChIKey | SPAPKFUJIGQDCD-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.35 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone?
The IUPAC name of 1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone (CID 10733050) is 1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone.
What is the SMILES notation for 1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone?
The canonical SMILES for 1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone is CC(=O)C1=C(c2ccccc2)Oc2ccccc2-n2cccc21.
What is the InChIKey of 1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone?
The InChIKey is SPAPKFUJIGQDCD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H15NO2/c1-14(22)19-17-11-7-13-21(17)16-10-5-6-12-18(16)23-20(19)15-8-3-2-4-9-15/h2-13H,1H3.
What are the key properties of 1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone?
1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone has a molecular weight of 301.35 g/mol, XLogP of 4.33, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-phenylpyrrolo[2,1-d][1,5]benzoxazepin-7-yl)ethanone is sourced from PubChem (CID 10733050), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).