About 1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one
1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one (PubChem CID 10733083) has the molecular formula C20H31NO
and a molecular weight of 301.47 g/mol. Its IUPAC name is 1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one.
Molecular Properties
| Compound Name | 1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one |
| PubChem CID | 10733083 |
| Molecular Formula | C20H31NO |
| Molecular Weight | 301.47 g/mol |
| Exact Mass | 301.24 |
| IUPAC Name | 1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one |
| SMILES | CCCCC(=O)c1cc(C(C)(C)C)c2c(c1)C(C)(C)CCN2 |
| InChI | InChI=1S/C20H31NO/c1-7-8-9-17(22)14-12-15(19(2,3)4)18-16(13-14)20(5,6)10-11-21-18/h12-13,21H,7-11H2,1-6H3 |
| InChIKey | BOGMVSVXDOKODC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 301.47 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one?
The IUPAC name of 1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one (CID 10733083) is 1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one.
What is the SMILES notation for 1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one?
The canonical SMILES for 1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one is CCCCC(=O)c1cc(C(C)(C)C)c2c(c1)C(C)(C)CCN2.
What is the InChIKey of 1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one?
The InChIKey is BOGMVSVXDOKODC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H31NO/c1-7-8-9-17(22)14-12-15(19(2,3)4)18-16(13-14)20(5,6)10-11-21-18/h12-13,21H,7-11H2,1-6H3.
What are the key properties of 1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one?
1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one has a molecular weight of 301.47 g/mol, XLogP of 5.45, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-tert-butyl-4,4-dimethyl-2,3-dihydro-1H-quinolin-6-yl)pentan-1-one is sourced from PubChem (CID 10733083), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).