C11H7ClN4S — CID 107331331
3-chloro-4-(2-phenylpyrazol-3-yl)-1,2,5-thiadiazole (PubChem CID 107331331) has the molecular formula C11H7ClN4S and a molecular weight of 262.73 g/mol. Its IUPAC name is 3-chloro-4-(2-phenylpyrazol-3-yl)-1,2,5-thiadiazole.
| Compound Name | 3-chloro-4-(2-phenylpyrazol-3-yl)-1,2,5-thiadiazole |
|---|---|
| PubChem CID | 107331331 |
| Molecular Formula | C11H7ClN4S |
| Molecular Weight | 262.73 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 3-chloro-4-(2-phenylpyrazol-3-yl)-1,2,5-thiadiazole |
| SMILES | Clc1nsnc1-c1ccnn1-c1ccccc1 |
| InChI | InChI=1S/C11H7ClN4S/c12-11-10(14-17-15-11)9-6-7-13-16(9)8-4-2-1-3-5-8/h1-7H |
| InChIKey | WZWQJHNMCNQNPN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.73 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |