C15H30N2O4 — CID 10733161
2,2-diethyl-N,N'-bis(1-hydroxy-2-methylpropan-2-yl)propanediamide (PubChem CID 10733161) has the molecular formula C15H30N2O4 and a molecular weight of 302.42 g/mol. Its IUPAC name is 2,2-diethyl-N,N'-bis(1-hydroxy-2-methylpropan-2-yl)propanediamide.
| Compound Name | 2,2-diethyl-N,N'-bis(1-hydroxy-2-methylpropan-2-yl)propanediamide |
|---|---|
| PubChem CID | 10733161 |
| Molecular Formula | C15H30N2O4 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.22 |
| IUPAC Name | 2,2-diethyl-N,N'-bis(1-hydroxy-2-methylpropan-2-yl)propanediamide |
| SMILES | CCC(CC)(C(=O)NC(C)(C)CO)C(=O)NC(C)(C)CO |
| InChI | InChI=1S/C15H30N2O4/c1-7-15(8-2,11(20)16-13(3,4)9-18)12(21)17-14(5,6)10-19/h18-19H,7-10H2,1-6H3,(H,16,20)(H,17,21) |
| InChIKey | PVLTUVWPZZNABJ-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|