C17H20N2O — CID 107331781
2-cyclohexyl-1-(2-phenylpyrazol-3-yl)ethanone (PubChem CID 107331781) has the molecular formula C17H20N2O and a molecular weight of 268.36 g/mol. Its IUPAC name is 2-cyclohexyl-1-(2-phenylpyrazol-3-yl)ethanone.
| Compound Name | 2-cyclohexyl-1-(2-phenylpyrazol-3-yl)ethanone |
|---|---|
| PubChem CID | 107331781 |
| Molecular Formula | C17H20N2O |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.16 |
| IUPAC Name | 2-cyclohexyl-1-(2-phenylpyrazol-3-yl)ethanone |
| SMILES | O=C(CC1CCCCC1)c1ccnn1-c1ccccc1 |
| InChI | InChI=1S/C17H20N2O/c20-17(13-14-7-3-1-4-8-14)16-11-12-18-19(16)15-9-5-2-6-10-15/h2,5-6,9-12,14H,1,3-4,7-8,13H2 |
| InChIKey | IOWAROUKIKGEGR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |