C16H13Br2N3 — CID 107332044
(2,5-dibromophenyl)-(2-phenylpyrazol-3-yl)methanamine (PubChem CID 107332044) has the molecular formula C16H13Br2N3 and a molecular weight of 407.11 g/mol. Its IUPAC name is (2,5-dibromophenyl)-(2-phenylpyrazol-3-yl)methanamine.
| Compound Name | (2,5-dibromophenyl)-(2-phenylpyrazol-3-yl)methanamine |
|---|---|
| PubChem CID | 107332044 |
| Molecular Formula | C16H13Br2N3 |
| Molecular Weight | 407.11 g/mol |
| Exact Mass | 404.95 |
| IUPAC Name | (2,5-dibromophenyl)-(2-phenylpyrazol-3-yl)methanamine |
| SMILES | NC(c1cc(Br)ccc1Br)c1ccnn1-c1ccccc1 |
| InChI | InChI=1S/C16H13Br2N3/c17-11-6-7-14(18)13(10-11)16(19)15-8-9-20-21(15)12-4-2-1-3-5-12/h1-10,16H,19H2 |
| InChIKey | FFMNKJIXWIFOSS-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.11 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |