C15H17BrF3NO — CID 107332950
[4-bromo-2-(trifluoromethyl)phenyl]-(3-propan-2-ylpyrrolidin-1-yl)methanone (PubChem CID 107332950) has the molecular formula C15H17BrF3NO and a molecular weight of 364.21 g/mol. Its IUPAC name is [4-bromo-2-(trifluoromethyl)phenyl]-(3-propan-2-ylpyrrolidin-1-yl)methanone.
| Compound Name | [4-bromo-2-(trifluoromethyl)phenyl]-(3-propan-2-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 107332950 |
| Molecular Formula | C15H17BrF3NO |
| Molecular Weight | 364.21 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | [4-bromo-2-(trifluoromethyl)phenyl]-(3-propan-2-ylpyrrolidin-1-yl)methanone |
| SMILES | CC(C)C1CCN(C(=O)c2ccc(Br)cc2C(F)(F)F)C1 |
| InChI | InChI=1S/C15H17BrF3NO/c1-9(2)10-5-6-20(8-10)14(21)12-4-3-11(16)7-13(12)15(17,18)19/h3-4,7,9-10H,5-6,8H2,1-2H3 |
| InChIKey | ZWDZABZNVIJKCJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.21 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |