C15H20N4O3 — CID 10733303
N-(diaminomethylidene)-2,2-dimethyl-3-oxo-4-propan-2-yl-1,4-benzoxazine-7-carboxamide (PubChem CID 10733303) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-(diaminomethylidene)-2,2-dimethyl-3-oxo-4-propan-2-yl-1,4-benzoxazine-7-carboxamide.
| Compound Name | N-(diaminomethylidene)-2,2-dimethyl-3-oxo-4-propan-2-yl-1,4-benzoxazine-7-carboxamide |
|---|---|
| PubChem CID | 10733303 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | N-(diaminomethylidene)-2,2-dimethyl-3-oxo-4-propan-2-yl-1,4-benzoxazine-7-carboxamide |
| SMILES | CC(C)N1C(=O)C(C)(C)Oc2cc(C(=O)N=C(N)N)ccc21 |
| InChI | InChI=1S/C15H20N4O3/c1-8(2)19-10-6-5-9(12(20)18-14(16)17)7-11(10)22-15(3,4)13(19)21/h5-8H,1-4H3,(H4,16,17,18,20) |
| InChIKey | AQPTZNLNQRONOP-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 111.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|