C14H7Cl2F3O2 — CID 107333223
4-(2,5-dichlorophenyl)-2-(trifluoromethyl)benzoic acid (PubChem CID 107333223) has the molecular formula C14H7Cl2F3O2 and a molecular weight of 335.11 g/mol. Its IUPAC name is 4-(2,5-dichlorophenyl)-2-(trifluoromethyl)benzoic acid.
| Compound Name | 4-(2,5-dichlorophenyl)-2-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 107333223 |
| Molecular Formula | C14H7Cl2F3O2 |
| Molecular Weight | 335.11 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | 4-(2,5-dichlorophenyl)-2-(trifluoromethyl)benzoic acid |
| SMILES | O=C(O)c1ccc(-c2cc(Cl)ccc2Cl)cc1C(F)(F)F |
| InChI | InChI=1S/C14H7Cl2F3O2/c15-8-2-4-12(16)10(6-8)7-1-3-9(13(20)21)11(5-7)14(17,18)19/h1-6H,(H,20,21) |
| InChIKey | UKGOWEOVKOQRIG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.11 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |