C14H16Br2F3NO — CID 107333532
4-bromo-N-(3-bromopropyl)-N-propan-2-yl-2-(trifluoromethyl)benzamide (PubChem CID 107333532) has the molecular formula C14H16Br2F3NO and a molecular weight of 431.09 g/mol. Its IUPAC name is 4-bromo-N-(3-bromopropyl)-N-propan-2-yl-2-(trifluoromethyl)benzamide.
| Compound Name | 4-bromo-N-(3-bromopropyl)-N-propan-2-yl-2-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 107333532 |
| Molecular Formula | C14H16Br2F3NO |
| Molecular Weight | 431.09 g/mol |
| Exact Mass | 428.96 |
| IUPAC Name | 4-bromo-N-(3-bromopropyl)-N-propan-2-yl-2-(trifluoromethyl)benzamide |
| SMILES | CC(C)N(CCCBr)C(=O)c1ccc(Br)cc1C(F)(F)F |
| InChI | InChI=1S/C14H16Br2F3NO/c1-9(2)20(7-3-6-15)13(21)11-5-4-10(16)8-12(11)14(17,18)19/h4-5,8-9H,3,6-7H2,1-2H3 |
| InChIKey | MJBYGIXVFWBGCZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.09 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|