C17H17F2NO2 — CID 10733367
methyl (E)-3-[1-[(2,4-difluorophenyl)methyl]-4-methyl-4H-pyridin-3-yl]prop-2-enoate (PubChem CID 10733367) has the molecular formula C17H17F2NO2 and a molecular weight of 305.32 g/mol. Its IUPAC name is methyl (E)-3-[1-[(2,4-difluorophenyl)methyl]-4-methyl-4H-pyridin-3-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[1-[(2,4-difluorophenyl)methyl]-4-methyl-4H-pyridin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10733367 |
| Molecular Formula | C17H17F2NO2 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | methyl (E)-3-[1-[(2,4-difluorophenyl)methyl]-4-methyl-4H-pyridin-3-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/C1=CN(Cc2ccc(F)cc2F)C=CC1C |
| InChI | InChI=1S/C17H17F2NO2/c1-12-7-8-20(10-13(12)4-6-17(21)22-2)11-14-3-5-15(18)9-16(14)19/h3-10,12H,11H2,1-2H3/b6-4+ |
| InChIKey | UGYXSUUHKOETNQ-GQCTYLIASA-N |
| XLogP | 3.54 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|