C18H27NO3 — CID 10733392
tert-butyl N-benzyl-N-[(2R,3R)-2-propyloxetan-3-yl]carbamate (PubChem CID 10733392) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is tert-butyl N-benzyl-N-[(2R,3R)-2-propyloxetan-3-yl]carbamate.
| Compound Name | tert-butyl N-benzyl-N-[(2R,3R)-2-propyloxetan-3-yl]carbamate |
|---|---|
| PubChem CID | 10733392 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | tert-butyl N-benzyl-N-[(2R,3R)-2-propyloxetan-3-yl]carbamate |
| SMILES | CCC[C@H]1OC[C@H]1N(Cc1ccccc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H27NO3/c1-5-9-16-15(13-21-16)19(17(20)22-18(2,3)4)12-14-10-7-6-8-11-14/h6-8,10-11,15-16H,5,9,12-13H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | FVDKNWXNGBERJZ-HZPDHXFCSA-N |
| XLogP | 3.99 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |