C11H10ClFN2O2S2 — CID 107334288
N-(3-amino-5-fluorophenyl)-5-chloro-4-methylthiophene-2-sulfonamide (PubChem CID 107334288) has the molecular formula C11H10ClFN2O2S2 and a molecular weight of 320.80 g/mol. Its IUPAC name is N-(3-amino-5-fluorophenyl)-5-chloro-4-methylthiophene-2-sulfonamide.
| Compound Name | N-(3-amino-5-fluorophenyl)-5-chloro-4-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107334288 |
| Molecular Formula | C11H10ClFN2O2S2 |
| Molecular Weight | 320.80 g/mol |
| Exact Mass | 319.99 |
| IUPAC Name | N-(3-amino-5-fluorophenyl)-5-chloro-4-methylthiophene-2-sulfonamide |
| SMILES | Cc1cc(S(=O)(=O)Nc2cc(N)cc(F)c2)sc1Cl |
| InChI | InChI=1S/C11H10ClFN2O2S2/c1-6-2-10(18-11(6)12)19(16,17)15-9-4-7(13)3-8(14)5-9/h2-5,15H,14H2,1H3 |
| InChIKey | RXBBQYCEDHRGPM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.80 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|