About N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide
N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide (PubChem CID 107335226) has the molecular formula C6H7F3N4O
and a molecular weight of 208.14 g/mol. Its IUPAC name is N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide.
Molecular Properties
| Compound Name | N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide |
| PubChem CID | 107335226 |
| Molecular Formula | C6H7F3N4O |
| Molecular Weight | 208.14 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide |
| SMILES | Cn1ncc(N)c1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C6H7F3N4O/c1-13-4(3(10)2-11-13)12-5(14)6(7,8)9/h2H,10H2,1H3,(H,12,14) |
| InChIKey | OGWPOLQCGVGAQK-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.14 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide?
The IUPAC name of N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide (CID 107335226) is N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide.
What is the SMILES notation for N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide?
The canonical SMILES for N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide is Cn1ncc(N)c1NC(=O)C(F)(F)F.
What is the InChIKey of N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide?
The InChIKey is OGWPOLQCGVGAQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7F3N4O/c1-13-4(3(10)2-11-13)12-5(14)6(7,8)9/h2H,10H2,1H3,(H,12,14).
What are the key properties of N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide?
N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide has a molecular weight of 208.14 g/mol, XLogP of 0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-amino-1-methylpyrazol-5-yl)-2,2,2-trifluoroacetamide is sourced from PubChem (CID 107335226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).