C17H25NO4 — CID 10733533
tert-butyl (3R,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate (PubChem CID 10733533) has the molecular formula C17H25NO4 and a molecular weight of 307.39 g/mol. Its IUPAC name is tert-butyl (3R,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (3R,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 10733533 |
| Molecular Formula | C17H25NO4 |
| Molecular Weight | 307.39 g/mol |
| Exact Mass | 307.18 |
| IUPAC Name | tert-butyl (3R,5S)-2-benzyl-5-ethoxy-1,2-oxazolidine-3-carboxylate |
| SMILES | CCO[C@@H]1C[C@H](C(=O)OC(C)(C)C)N(Cc2ccccc2)O1 |
| InChI | InChI=1S/C17H25NO4/c1-5-20-15-11-14(16(19)21-17(2,3)4)18(22-15)12-13-9-7-6-8-10-13/h6-10,14-15H,5,11-12H2,1-4H3/t14-,15+/m1/s1 |
| InChIKey | ZQIQSGAPSZGWLL-CABCVRRESA-N |
| XLogP | 2.90 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.39 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |