About methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate
methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate (PubChem CID 10733626) has the molecular formula C19H32O3
and a molecular weight of 308.46 g/mol. Its IUPAC name is methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate.
Molecular Properties
| Compound Name | methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate |
| PubChem CID | 10733626 |
| Molecular Formula | C19H32O3 |
| Molecular Weight | 308.46 g/mol |
| Exact Mass | 308.24 |
| IUPAC Name | methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate |
| SMILES | CC/C=C\C[C@H]1C(=O)CC[C@@H]1CCCCCCCC(=O)OC |
| InChI | InChI=1S/C19H32O3/c1-3-4-8-12-17-16(14-15-18(17)20)11-9-6-5-7-10-13-19(21)22-2/h4,8,16-17H,3,5-7,9-15H2,1-2H3/b8-4-/t16-,17+/m0/s1 |
| InChIKey | XOZWUZWSKNEMSR-HBKWROQRSA-N |
| XLogP | 4.84 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate?
The IUPAC name of methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate (CID 10733626) is methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate.
What is the SMILES notation for methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate?
The canonical SMILES for methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate is CC/C=C\C[C@H]1C(=O)CC[C@@H]1CCCCCCCC(=O)OC.
What is the InChIKey of methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate?
The InChIKey is XOZWUZWSKNEMSR-HBKWROQRSA-N. The full InChI is InChI=1S/C19H32O3/c1-3-4-8-12-17-16(14-15-18(17)20)11-9-6-5-7-10-13-19(21)22-2/h4,8,16-17H,3,5-7,9-15H2,1-2H3/b8-4-/t16-,17+/m0/s1.
What are the key properties of methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate?
methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate has a molecular weight of 308.46 g/mol, XLogP of 4.84, 11 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-[(1S,2R)-3-oxo-2-[(Z)-pent-2-enyl]cyclopentyl]octanoate is sourced from PubChem (CID 10733626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).