C14H16BrF3N2O — CID 107336794
1-[3-bromo-4-(trifluoromethoxy)phenyl]-N-cyclopropylpyrrolidin-3-amine (PubChem CID 107336794) has the molecular formula C14H16BrF3N2O and a molecular weight of 365.19 g/mol. Its IUPAC name is 1-[3-bromo-4-(trifluoromethoxy)phenyl]-N-cyclopropylpyrrolidin-3-amine.
| Compound Name | 1-[3-bromo-4-(trifluoromethoxy)phenyl]-N-cyclopropylpyrrolidin-3-amine |
|---|---|
| PubChem CID | 107336794 |
| Molecular Formula | C14H16BrF3N2O |
| Molecular Weight | 365.19 g/mol |
| Exact Mass | 364.04 |
| IUPAC Name | 1-[3-bromo-4-(trifluoromethoxy)phenyl]-N-cyclopropylpyrrolidin-3-amine |
| SMILES | FC(F)(F)Oc1ccc(N2CCC(NC3CC3)C2)cc1Br |
| InChI | InChI=1S/C14H16BrF3N2O/c15-12-7-11(3-4-13(12)21-14(16,17)18)20-6-5-10(8-20)19-9-1-2-9/h3-4,7,9-10,19H,1-2,5-6,8H2 |
| InChIKey | VOXOMPQGXBOHNC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.19 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|