C12H15F3N2O3S — CID 107337059
6-amino-N-methyl-N-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-chromene-8-sulfonamide (PubChem CID 107337059) has the molecular formula C12H15F3N2O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is 6-amino-N-methyl-N-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-chromene-8-sulfonamide.
| Compound Name | 6-amino-N-methyl-N-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-chromene-8-sulfonamide |
|---|---|
| PubChem CID | 107337059 |
| Molecular Formula | C12H15F3N2O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 6-amino-N-methyl-N-(2,2,2-trifluoroethyl)-3,4-dihydro-2H-chromene-8-sulfonamide |
| SMILES | CN(CC(F)(F)F)S(=O)(=O)c1cc(N)cc2c1OCCC2 |
| InChI | InChI=1S/C12H15F3N2O3S/c1-17(7-12(13,14)15)21(18,19)10-6-9(16)5-8-3-2-4-20-11(8)10/h5-6H,2-4,7,16H2,1H3 |
| InChIKey | PVLOMGKZIUQGIK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|