C12H15F3N2O3S — CID 107337123
6-amino-N-(3,3,3-trifluoropropyl)-3,4-dihydro-2H-chromene-8-sulfonamide (PubChem CID 107337123) has the molecular formula C12H15F3N2O3S and a molecular weight of 324.32 g/mol. Its IUPAC name is 6-amino-N-(3,3,3-trifluoropropyl)-3,4-dihydro-2H-chromene-8-sulfonamide.
| Compound Name | 6-amino-N-(3,3,3-trifluoropropyl)-3,4-dihydro-2H-chromene-8-sulfonamide |
|---|---|
| PubChem CID | 107337123 |
| Molecular Formula | C12H15F3N2O3S |
| Molecular Weight | 324.32 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 6-amino-N-(3,3,3-trifluoropropyl)-3,4-dihydro-2H-chromene-8-sulfonamide |
| SMILES | Nc1cc2c(c(S(=O)(=O)NCCC(F)(F)F)c1)OCCC2 |
| InChI | InChI=1S/C12H15F3N2O3S/c13-12(14,15)3-4-17-21(18,19)10-7-9(16)6-8-2-1-5-20-11(8)10/h6-7,17H,1-5,16H2 |
| InChIKey | BZMITTAGNVRGAZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|